P09884 | DPOLA_HUMAN | DNA polymerase alpha catalytic subunit (POLA1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00136 | DNA_pol_B - DNA polymerase family B | 775~1227 | |
| PF03104 | DNA_pol_B_exo1 - DNA polymerase family B, exonuclease domain | 475~710 | |
| PF08996 | zf-DNA_Pol - DNA Polymerase alpha zinc finger | 1266~1455 | |
| PF12254 | DNA_pol_alpha_N - DNA polymerase alpha subunit p180 N terminal | 35~96 |
3D structures mapped by conservation among orthologs
[ Domain: "Nucleic acid-binding proteins" // DNA_pol_B_exo1_2nd ]
[ Domain: ""thumb" domain in bacteriophage RB69-like DNA polymerase I" // DNA_pol_B_2nd ]
[ Domain: ""fingers" domain in bacteriophage RB69-like DNA polymerase I" // DNA_pol_B_1st_2 ]
[ Domain: "Adenylyl and guanylyl cyclase catalytic domain-like" // DNA_pol_B_1st_1 ]
[ Domain: "Family B DNA polymerase insertion domain" // DNA_pol_B_exo1_1st_1 ]
[ Domain: "Ribonuclease H-like" // DNA_pol_B_exo1_3rd ]
[ Domain: "Zinc finger domain of DNA polymerase-alpha" // zf-DNA_Pol_N ]
[ Domain: "Zinc finger domain of DNA polymerase-alpha" // zf-DNA_Pol_C ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1173055 |  |
IC50 | = | 0.4 | nM | 323.37 | CNCc1ccc(-c2[nH]c3cc(F)cc4c3c2CCNC4=O)cc1 | Homo sapiens | CHEMBL5346646 | single protein format |
| CHEMBL483492 |  |
IC50 | = | 15.0 | nM | 483.18 | Cc1cn([C@@H]2C[C@@H](F)[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)nc1N | Homo sapiens | CHEMBL662220 | single protein format |
| CHEMBL2092833 |  |
IC50 | = | 480.0 | nM | 484.16 | Cc1cn([C@@H]2C[C@@H](F)[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]c1=O | Homo sapiens | CHEMBL662220 | single protein format |
| CHEMBL5281189 |  |
IC50 | = | 680.0 | nM | 372.33 | COc1cc(OC(C)=O)c2c(c1)C1(C=C(OC(C)=O)C(=O)C=C1C)OC2=O | Homo sapiens | CHEMBL5230712 | single protein format |
| CHEMBL2092835 |  |
IC50 | = | 800.0 | nM | 469.15 | Nc1ccn([C@@H]2C[C@@H](F)[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 | Homo sapiens | CHEMBL662220 | single protein format |
| CHEMBL220940 |  |
IC50 | = | 1000.0 | nM | 498.17 | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O | Homo sapiens | CHEMBL662220 | single protein format |
| CHEMBL366356 |  |
Ki | = | 830.0 | nM | 322.23 | O=C(O)c1cc(O)c(O)c(OC(=O)c2cc(O)c(O)c(O)c2)c1 | Homo sapiens | CHEMBL1018084 | cell-based format |
| CHEMBL278903 |  |
Ki | = | 1000.0 | nM | 313.43 | CCCCc1ccc(Nc2nc(SC)c3[nH]cnc3n2)cc1 | Homo sapiens | CHEMBL659772 | single protein format |