P07814 | SYEP_HUMAN | Bifunctional glutamate/proline--tRNA ligase (EPRS1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00458 | WHEP-TRS | 753–805 | |
| PF00458 | WHEP-TRS | 826–878 | |
| PF00458 | WHEP-TRS | 904–955 | |
| PF00587 | tRNA-synt_2b | 1113–1284 | |
| PF00749 | tRNA-synt_1c | 197–501 | |
| PF03129 | HGTP_anticodon | 1303–1403 | |
| PF03950 | tRNA-synt_1c_C | 504–594 | |
| PF09180 | ProRS-C_1 | 1430–1512 | |
| PF20974 | tRNA-synt_1c_C2 | 606–681 | |
| PF21972 | Arc1p_N_like | 92–155 |
3D structures mapped by conservation among orthologs
[ Domain: "S15/NS1 RNA-binding domain" // WHEP-TRS ]
[ Domain: "Glutathione S-transferase (GST)-C" // GST_C_3 ]
[ Domain: "C-terminal domain of ProRS" // ProRS-C_1 ]
[ Domain: "Class II aaRS and biotin synthetases" // tRNA-synt_2b ]
[ Domain: "Anticodon-binding domain of Class II aaRS" // HGTP_anticodon ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1163086 |  |
Ki | = | 0.6 | nM | 443.44 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)[C@@H]2CCCN2)[C@@H](O)[C@H]1O | Homo sapiens | CHEMBL5257976 | single protein format |
| CHEMBL357355 |  |
Ki | = | 15.0 | nM | 376.64 | Cc1cc(Cl)cc2c(C(=O)O)cc(-c3ccc(Br)cc3)nc12 | Homo sapiens | CHEMBL844882 | single protein format |
| CHEMBL5279127 |  |
Ki | = | 85.0 | nM | 443.44 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)[C@H]2CCCN2)[C@@H](O)[C@H]1O | Homo sapiens | CHEMBL5257976 | single protein format |