P07101 | TY3H_HUMAN | Tyrosine 3-monooxygenase (TH)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00351 | Biopterin_H - Biopterin-dependent aromatic amino acid hydroxylase | 195~524 | |
| PF12549 | TOH_N - Tyrosine hydroxylase N terminal | 2~26 | |
| PF12549 | TOH_N - Tyrosine hydroxylase N terminal | 56~80 | |
| PF21417 | TH_ACT - Tyrosine 3-monooxygenase-like, ACT domain | 110~178 |
3D structures mapped by conservation among orthologs
[ Domain: "Aromatic aminoacid monoxygenases, catalytic and oligomerization domains" // Biopterin_H ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL225230 |  |
IC50 | = | 300.0 | nM | 295.38 | CCCN1CCc2cccc3c2[C@H]1Cc1ccc(O)c(O)c1-3 | Homo sapiens | CHEMBL944157 | single protein format |
| CHEMBL479789 |  |
IC50 | = | 720.0 | nM | 307.09 | N[C@@H](Cc1ccc(O)c(I)c1)C(=O)O | Homo sapiens | CHEMBL984790 | single protein format |
| CHEMBL330274 |  |
IC50 | = | 1000.0 | nM | 295.38 | CCCN1CCc2cccc3c2[C@@H]1Cc1ccc(O)c(O)c1-3 | Homo sapiens | CHEMBL944157 | single protein format |