P05067 | A4_HUMAN | Amyloid-beta precursor protein (APP)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00014 | Kunitz_BPTI - Kunitz/Bovine pancreatic trypsin inhibitor domain | 290~341 | |
| PF02177 | APP_N - Amyloid A4 N-terminal heparin-binding | 31~131 | |
| PF03494 | Beta-APP - Beta-amyloid peptide (beta-APP) | 676~713 | |
| PF10515 | APP_amyloid - Beta-amyloid precursor protein C-terminus | 716~766 | |
| PF12924 | APP_Cu_bd - Copper-binding of amyloid precursor, CuBD | 132~188 | |
| PF12925 | APP_E2 - E2 domain of amyloid precursor protein | 367~548 |
3D structures mapped by conservation among orthologs
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // Beta-APP ]
[ Domain: "CAPPD, an extracellular domain of amyloid beta A4 protein" // APP_E2 ]
[ Domain: "Amyloid beta a4 protein copper binding domain (domain 2)" // APP_Cu_bd ]
[ Domain: "A heparin-binding domain" // APP_N ]
[ Domain: "BPTI-like" // Kunitz_BPTI ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1091513 |  |
IC50 | = | 0.65 | nM | 517.93 | O=S(=O)(NC1CCC(c2cc(F)ccc2F)(S(=O)(=O)c2ccc(Cl)cc2)CC1)C(F)(F)F | Homo sapiens | CHEMBL4882624 | single protein format |
| CHEMBL4110988 |  |
IC50 | = | 0.7 | nM | 363.51 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(C#CC(C)C)cc1[C@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705693 | cell-based format |
| CHEMBL3898248 |  |
IC50 | = | 0.7 | nM | 409.45 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCCC(F)(F)F)cc1[C@@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705693 | cell-based format |
| CHEMBL3902640 |  |
IC50 | = | 0.8 | nM | 450.95 | CO[C@H]1CC[C@]2(CC1)Cc1cc(F)c(-c3cc(Cl)cc(C#N)c3)cc1[C@@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705694 | cell-based format |
| CHEMBL3939963 |  |
IC50 | = | 0.8 | nM | 381.52 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCCC3CC3)cc1C21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705769 | cell-based format |
| CHEMBL3937398 |  |
IC50 | = | 0.9 | nM | 367.49 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCC3CC3)cc1[C@@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705769 | cell-based format |
| CHEMBL3672723 |  |
IC50 | = | 1.0 | nM | 442.56 | COc1cc(C#N)cc(-c2ccc3c(c2)C2(N=C(C)C(N)=N2)[C@]2(CC3)CC[C@@H](OC)CC2)c1 | Homo sapiens | CHEMBL3705766 | cell-based format |
| CHEMBL5093303 |  |
IC50 | = | 1.0 | nM | 455.4 | C[C@@]1(c2cc(NC(=O)c3ccc(OC(F)F)cn3)ccc2F)Cn2nc(C#N)cc2C(N)=N1 | Homo sapiens | CHEMBL5041730 | cell-based format |
| CHEMBL1086286 |  |
IC50 | = | 1.0 | nM | 520.02 | CCS(=O)(=O)NC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12 | Homo sapiens | CHEMBL3705103 | single protein format |
| CHEMBL5084378 |  |
IC50 | = | 1.0 | nM | 414.4 | C[C@@]1(c2cc(NC(=O)c3ccc(C#N)cn3)ccc2F)Cn2nc(C#N)cc2C(N)=N1 | Homo sapiens | CHEMBL5041730 | cell-based format |
| CHEMBL3653726 |  |
IC50 | = | 1.0 | nM | 398.51 | CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)[C@]2(CC[C@H](O)CC2)C3)c1 | Homo sapiens | CHEMBL3705693 | cell-based format |
| CHEMBL5082406 |  |
IC50 | = | 1.2 | nM | 438.4 | C[C@@]1(c2cc(NC(=O)c3cnc(OCF)cn3)ccc2F)Cn2nc(C#N)cc2C(N)=N1 | Homo sapiens | CHEMBL5041730 | cell-based format |
| CHEMBL5074068 |  |
IC50 | = | 1.3 | nM | 420.41 | COc1cnc(C(=O)Nc2ccc(F)c([C@]3(C)Cn4nc(C#N)cc4C(N)=N3)c2)cn1 | Homo sapiens | CHEMBL5041730 | cell-based format |
| CHEMBL3927449 |  |
IC50 | = | 1.3 | nM | 381.52 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCC3CCC3)cc1[C@@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705769 | cell-based format |
| CHEMBL3943313 |  |
IC50 | = | 1.4 | nM | 587.07 | O=S(=O)(CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12)CCn1cccn1 | Homo sapiens | CHEMBL3887819 | assay format |
| CHEMBL3961886 |  |
IC50 | = | 1.5 | nM | 381.52 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCC3CCC3)cc1C21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705769 | cell-based format |
| CHEMBL3672695 |  |
IC50 | = | 1.6 | nM | 409.45 | CC1=N[C@]2(N=C1N)c1cc(OCCCF)ccc1C[C@]21CC[C@@H](OC(F)F)CC1 | Homo sapiens | CHEMBL3705693 | cell-based format |
| CHEMBL3672698 |  |
IC50 | = | 1.6 | nM | 418.93 | CC1=N[C@]2(N=C1N)c1cc(-c3cc(Cl)cc(C#N)c3)ccc1C[C@]21CC[C@@H](O)CC1 | Homo sapiens | CHEMBL3705693 | cell-based format |
| CHEMBL3923244 |  |
IC50 | = | 1.6 | nM | 367.49 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(OCC3CC3)cc1C21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705769 | cell-based format |
| CHEMBL3893021 |  |
IC50 | = | 1.6 | nM | 363.51 | CO[C@H]1CC[C@]2(CC1)Cc1ccc(C#CC(C)C)cc1[C@@]21N=C(C)C(N)=N1 | Homo sapiens | CHEMBL3705693 | cell-based format |