P04053 | TDT_HUMAN | DNA nucleotidylexotransferase (DNTT)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00533 | BRCT - BRCA1 C Terminus (BRCT) domain | 29~111 | |
| PF01909 | NTP_transf_2 - Nucleotidyltransferase domain | 319~403 | |
| PF10391 | DNA_pol_lambd_f - Fingers domain of DNA polymerase lambda | 250~299 | |
| PF14716 | HHH_8 - Helix-hairpin-helix domain | 165~233 | |
| PF14791 | DNA_pol_B_thumb - DNA polymerase beta thumb | 445~508 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL2441983 |  |
Ki | = | 400.0 | nM | 329.28 | O=C(/C=C/c1cc(C(=O)c2ccccc2F)c[nH]1)CC(=O)C(=O)O | Homo sapiens | CHEMBL2445052 | single protein format |
| CHEMBL2441974 |  |
Ki | = | 500.0 | nM | 363.37 | O=C(/C=C/c1cn(Cc2ccc(O)cc2)c2ccccc12)CC(=O)C(=O)O | Homo sapiens | CHEMBL2445052 | single protein format |