P01137 | TGFB1_HUMAN | Transforming growth factor beta-1 proprotein (TGFB1)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00019 | TGF_beta | 292–389 | |
| PF00688 | TGFb_propeptide | 31–261 |
3D structures mapped by conservation among orthologs
[ Domain: "Nucleoplasmin-like/VP (viral coat and capsid proteins)" // TGFb_propeptide ]
[ Domain: "Cystine-knot cytokines" // TGF_beta ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3260567 | IC50 | = | 12.9 | nM | 399.43 | Cc1cccc(-c2[nH]c(CNc3ccccc3F)nc2-c2ccc3ncnn3c2)n1 | Homo sapiens | CHEMBL5241488 | single protein format | |
| CHEMBL5280211 | IC50 | = | 38.2 | nM | 433.56 | CC(C)(C)c1cc(Nc2cc(Oc3cn(C4CC4)nc3C3CCOCC3)ccn2)ccn1 | Homo sapiens | CHEMBL5241488 | single protein format | |
| CHEMBL5272606 | IC50 | = | 56.0 | nM | 369.43 | Cc1cc(-c2ccnc3ccc(C(N)=O)cc23)cc(-c2cc3n(n2)CCC3)n1 | Homo sapiens | CHEMBL5241488 | single protein format |
