P01031 | CO5_HUMAN | Complement C5 (C5)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00207 | A2M | 772–859 | |
| PF01759 | NTR | 1551–1658 | |
| PF01821 | ANATO | 698–732 | |
| PF01835 | MG2 | 126–219 | |
| PF07677 | A2M_recep | 1419–1510 | |
| PF07678 | TED_complement | 978–1300 | |
| PF07703 | A2M_BRD | 468–611 | |
| PF17789 | MG4 | 355–457 | |
| PF17790 | MG1 | 20–120 | |
| PF17791 | MG3 | 221–304 | |
| PF21309 | C5_CUB | 1311–1366 |
3D structures mapped by conservation among orthologs
[ Domain: "TIMP-like" // NTR ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // A2M_N_2 ]
[ Domain: "Common fold of diphtheria toxin/transcription factors/cytochrome f" // A2M_recep ]
[ Domain: "alpha/alpha toroid" // A2M_comp ]
[ Domain: "Anaphylotoxins (complement system)" // ANATO ]
[ Domain: "Spermadhesin, CUB domain" // EUF07662 ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // A2M_N_1 ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // KOG1366_2nd_1 ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // MG4 ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // KOG1366_1st ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // ANATO,A2M_N_2 ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // A2M_C ]
[ Domain: "Immunoglobulin/Fibronectin type III/E set domains/PapD-like" // A2M_N ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4757748 |  |
IC50 | <= | 5.0 | nM | 400.52 | COc1ccc(NC(=O)N[C@@H](C)c2ccccc2OC)cc1OCCCC(C)C | Homo sapiens | CHEMBL4668571 | cell-free format |
| CHEMBL2203296 |  |
IC50 | = | 210.0 | nM | 370.49 | CCCCCCOc1cc(NC(=O)N[C@@H](C)c2ccccc2)ccc1OC | Homo sapiens | CHEMBL4668571 | cell-free format |
| CHEMBL2204196 |  |
IC50 | = | 440.0 | nM | 370.49 | COc1ccc(NC(=O)N[C@@H](C)c2ccccc2)cc1OCCCC(C)C | Homo sapiens | CHEMBL4668571 | cell-free format |
| CHEMBL4756677 |  |
IC50 | = | 620.0 | nM | 414.5 | COc1cc(C(=O)O)c(NC(=O)N[C@@H](C)c2ccccc2)cc1OCCCC(C)C | Homo sapiens | CHEMBL4668571 | cell-free format |