P00395 | COX1_HUMAN | Cytochrome c oxidase subunit 1 (MT-CO1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00115 | COX1 - Cytochrome C and Quinol oxidase polypeptide I | 14~460 |
3D structures mapped by conservation among orthologs
[ Domain: "Cytochrome c oxidase subunit I-like" // COX1 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL1774043 |  |
IC50 | = | 130.0 | nM | 576.63 | COc1ccc(-c2cnc(C(=O)N3CCN(c4cc(C(=O)O)c5ccccc5c4)CC3)nc2-c2ccc(C)cc2F)cc1 | Homo sapiens | CHEMBL1775456 | single protein format |
| CHEMBL441414 |  |
IC50 | = | 500.0 | nM | 248.32 | C[C@H](C(=O)O)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 | Homo sapiens | CHEMBL5162740 | single protein format |