O95622 | ADCY5_HUMAN | Adenylate cyclase type 5 (ADCY5)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00211 | Guanylate_cyc - Adenylate and Guanylate cyclase catalytic domain | 460~621 | |
| PF00211 | Guanylate_cyc - Adenylate and Guanylate cyclase catalytic domain | 1063~1256 | |
| PF06327 | Adcy_cons_dom - Adenylate cyclase, conserved domain | 669~761 | |
| PF16214 | AC_N - Adenylyl cyclase N-terminal extracellular and transmembrane region | 1~458 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL432908 |  |
IC50 | = | 200.0 | nM | 262.27 | Nc1ncnc2c1ncn2[C@H]1CC[C@H](C(=O)NO)C1 | Homo sapiens | CHEMBL645674 | cell-based format |
| CHEMBL69185 |  |
IC50 | = | 400.0 | nM | 274.28 | Nc1ncnc2c1ncn2[C@H]1C=C[C@H](CC(=O)NO)C1 | Homo sapiens | CHEMBL645674 | cell-based format |
| CHEMBL69184 |  |
IC50 | = | 600.0 | nM | 276.3 | Nc1ncnc2c1ncn2[C@@H]1CC[C@@H](CC(=O)NO)C1 | Homo sapiens | CHEMBL645674 | cell-based format |