O95398 | RPGF3_HUMAN | Rap guanine nucleotide exchange factor 3 (RAPGEF3)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00027 | cNMP_binding - Cyclic nucleotide-binding domain | 268~347 | |
| PF00610 | DEP - Domain found in Dishevelled, Egl-10, and Pleckstrin (DEP) | 116~184 | |
| PF00617 | RasGEF - RasGEF domain | 665~843 | |
| PF00618 | RasGEF_N - RasGEF N-terminal motif | 387~492 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4517829 |  |
IC50 | = | 900.0 | nM | 416.46 | COc1ccc2ccc(OCC(=O)NS(=O)(=O)c3ccc(N)cc3OC)cc2c1 | Homo sapiens | CHEMBL4346467 | assay format |