O75747 | P3C2G_HUMAN | Phosphatidylinositol 3-kinase C2 domain-containing subunit gamma (PIK3C2G)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00168 | C2 - C2 domain | 1383~1481 | |
| PF00454 | PI3_PI4_kinase - Phosphatidylinositol 3- and 4-kinase | 957~1170 | |
| PF00613 | PI3Ka - Phosphoinositide 3-kinase family, accessory domain (PIK domain) | 704~858 | |
| PF00787 | PX - PX domain | 1268~1347 | |
| PF00792 | PI3K_C2 - Phosphoinositide 3-kinase C2 | 546~640 | |
| PF00794 | PI3K_rbd - PI3-kinase family, ras-binding domain | 281~367 |
3D structures mapped by conservation among orthologs
[ Domain: "PX domain" // PX ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3360227 |  |
IC50 | = | 340.0 | nM | 401.45 | COc1cc(Nc2nccnc2NS(=O)(=O)c2cccc(N)c2)cc(OC)c1 | Homo sapiens | CHEMBL3375584 | single protein format |
| CHEMBL5400057 |  |
IC50 | = | 858.0 | nM | 424.51 | O=C(CSc1nc2nccnc2c(=O)n1CCc1ccccc1)Nc1nccs1 | Homo sapiens | CHEMBL5373589 | single protein format |
| CHEMBL3785311 |  |
IC50 | = | 1000.0 | nM | 487.6 | COc1ccc(-c2sc(NC(=O)C3CCCC3)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 | Homo sapiens | CHEMBL3789699 | cell-based format |
| CHEMBL3786230 |  |
IC50 | = | 1000.0 | nM | 475.59 | COc1ccc(-c2sc(NC(=O)C(C)(C)C)nc2C)cc1S(=O)(=O)Nc1ccc(O)cc1 | Homo sapiens | CHEMBL3789699 | cell-based format |