O75475 | PSIP1_HUMAN | PC4 and SFRS1-interacting protein (PSIP1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00855 | PWWP - PWWP domain | 8~87 | |
| PF11467 | LEDGF - Lens epithelium-derived growth factor (LEDGF) | 349~449 |
3D structures mapped by conservation among orthologs
[ Domain: "SH3" // PWWP ]
[ Domain: "Conserved domain common to transcription factors TFIIS, elongin A, CRSP70" // LEDGF ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL3981070 |  |
IC50 | = | 470.0 | nM | 387.52 | CCCC(C(=O)O)c1c(C)nc2cc3c(cc2c1-c1ccc(C)cc1)CCCC3 | Homo sapiens | CHEMBL3887244 | single protein format |
| CHEMBL3966037 |  |
IC50 | = | 470.0 | nM | 387.52 | CCCC(C(=O)O)c1c(C)nc2ccc3c(c2c1-c1ccc(C)cc1)CCCC3 | Homo sapiens | CHEMBL3887244 | single protein format |
| CHEMBL3964350 |  |
IC50 | = | 550.0 | nM | 417.55 | Cc1ccc(-c2c(C(OC(C)(C)C)C(=O)O)c(C)nc3cc4c(cc23)CCCC4)cc1 | Homo sapiens | CHEMBL3887245 | single protein format |