O60307 | MAST3_HUMAN | Microtubule-associated serine/threonine-protein kinase 3 (MAST3)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00069 | Pkinase - Protein kinase domain | 368~640 | |
| PF08926 | DUF1908 - Domain of unknown function (DUF1908) | 58~331 | |
| PF17820 | PDZ_6 - PDZ domain | 985~1024 |
3D structures mapped by conservation among orthologs
[ Domain: "PDZ domain" // PDZ ]
[ Domain: "MAST3 pre-PK domain-like" // DUF1908 ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL2420572 |  |
IC50 | = | 240.0 | nM | 441.54 | O=C(NC1(c2ccccc2)CC1)c1ccc2nc(N[C@H]3CC[C@H](O)CC3)c3nccn3c2c1 | Homo sapiens | CHEMBL2424216 | single protein format |
| CHEMBL2420564 |  |
IC50 | = | 290.0 | nM | 445.52 | O=C(N[C@H](CO)c1ccccc1)c1ccc2nc(N[C@H]3CC[C@H](O)CC3)c3nccn3c2c1 | Homo sapiens | CHEMBL2424216 | single protein format |
| CHEMBL2420555 |  |
IC50 | = | 740.0 | nM | 459.53 | O=C(NC1(c2ccc(F)cc2)CC1)c1ccc2nc(N[C@H]3CC[C@H](O)CC3)c3nccn3c2c1 | Homo sapiens | CHEMBL2424216 | single protein format |