O43184 | ADA12_HUMAN | Disintegrin and metalloproteinase domain-containing protein 12 (ADAM12)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00200 | Disintegrin | 433–505 | |
| PF01421 | Reprolysin | 214–416 | |
| PF01562 | Pep_M12B_propep | 61–126 | |
| PF08516 | ADAM_CR | 510–630 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL19611 | IC50 | = | 5.93 | nM | 388.47 | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](CC(=O)NO)CC(C)C | Homo sapiens | CHEMBL830979 | cell-based format | |
| CHEMBL366034 | IC50 | = | 16.7 | nM | 393.19 | O=C(O)CNC(=O)/C(=C\c1cccc(Br)c1)NC(=O)c1ccco1 | Homo sapiens | CHEMBL830979 | cell-based format | |
| CHEMBL361087 | IC50 | = | 24.8 | nM | 486.12 | CC(NC(=O)/C(=C\c1ccc(Br)cc1)NC(=O)c1ccc(Br)o1)C(=O)O | Homo sapiens | CHEMBL830979 | cell-based format | |
| CHEMBL188414 | IC50 | = | 40.5 | nM | 384.41 | CC(C)C(NC(=O)/C(=C\c1ccccc1F)NC(=O)c1ccccc1)C(=O)O | Homo sapiens | CHEMBL830979 | cell-based format | |
| CHEMBL365261 | IC50 | = | 42.3 | nM | 318.29 | CC(NC(=O)/C(=C\c1ccco1)NC(=O)c1ccco1)C(=O)O | Homo sapiens | CHEMBL830979 | cell-based format |
