O15269 | SPTC1_HUMAN | Serine palmitoyltransferase 1 (SPTLC1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00155 | Aminotran_1_2 - Aminotransferase class I and II | 99~464 |
3D structures mapped by conservation among orthologs
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4584997 |  |
IC50 | = | 5.19 | nM | 364.45 | CCCCCCC(=O)c1cc(-c2ccc(CC(=O)O)cc2)c2nccn2c1 | Homo sapiens | CHEMBL4477980 | microsome format |
| CHEMBL4541898 |  |
IC50 | = | 63.9 | nM | 411.55 | CCCCCCC(=O)N1CCc2c(c(-c3ccc(C(C)(C)C(=O)O)cc3)nn2C)C1 | Homo sapiens | CHEMBL4477980 | microsome format |