O14786 | NRP1_HUMAN | Neuropilin-1 (NRP1)
Pfam Domain Table
| Accession | Domain | Range | Color |
|---|---|---|---|
| PF00431 | CUB - CUB domain | 27~138 | |
| PF00431 | CUB - CUB domain | 147~262 | |
| PF00629 | MAM - MAM domain, meprin/A5/mu | 650~805 | |
| PF00754 | F5_F8_type_C - F5/8 type C domain | 290~421 | |
| PF00754 | F5_F8_type_C - F5/8 type C domain | 446~580 | |
| PF11980 | DUF3481 - C-terminal domain of neuropilin glycoprotein | 845~923 |
3D structures mapped by conservation among orthologs
[ Domain: "Concanavalin A-like lectins/glucanases" // MAM ]
[ Domain: "Galactose-binding domain-like" // F5_F8_type_C ]
[ Domain: "Spermadhesin, CUB domain" // CUB ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
| molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL4217624 |  |
IC50 | = | 609.0 | nM | 586.7 | N=C(N)NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cc(-c2ccc(CN)cc2)cc2c1OCC2)C(=O)O | Homo sapiens | CHEMBL4183435 | cell-based format |
| CHEMBL4279036 |  |
IC50 | = | 800.0 | nM | 541.66 | N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)C(CCN)NC(=O)C(N)CCCCN=C(N)N)C(=O)O | Homo sapiens | CHEMBL4268072 | single protein format |