O00429 | DNM1L_HUMAN | Dynamin-1-like protein (DNM1L)
Helixβ‑strandTurn secondary structure
Pfam Domain Table
Accession | Domain | Range | Color |
---|---|---|---|
PF00350 | Dynamin_N | 28–217 | |
PF01031 | Dynamin_M | 225–509 | |
PF02212 | GED | 639–730 |
3D structures mapped by conservation among orthologs
[ Domain: "Middle and GTPase effector domains in dynamin-related proteins" // Dynamin_M ]
[ Domain: "P-loop containing nucleoside triphosphate hydrolases" // Dynamin_N ]
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
Only the first 20 rows are shown.
molecule_chembl_id | structure | assay_type | relation | value | unit | mol_wt | smiles | organism | assay_chembl_id | bao_label |
---|---|---|---|---|---|---|---|---|---|---|
CHEMBL4471636 | IC50 | = | 720.0 | nM | 500.62 | Cc1cc(C(=O)Nc2ccc(-c3ccc(C(=O)O)cc3)cc2)n(Cc2csc(N3CCCCC3)n2)c1 | Homo sapiens | CHEMBL4418475 | single protein format | |
CHEMBL4467972 | IC50 | = | 910.0 | nM | 448.56 | Cc1cc(C(=O)Nc2ccc(-c3nn[nH]n3)cc2)n(Cc2csc(N3CCCCC3)n2)c1 | Homo sapiens | CHEMBL4418475 | single protein format |